C18H24N2O3S — CID 100613801
ethyl 2-[(2S)-1-[2-[(1R)-cyclohex-2-en-1-yl]acetyl]pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate (PubChem CID 100613801) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is ethyl 2-[(2S)-1-[2-[(1R)-cyclohex-2-en-1-yl]acetyl]pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(2S)-1-[2-[(1R)-cyclohex-2-en-1-yl]acetyl]pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 100613801 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | ethyl 2-[(2S)-1-[2-[(1R)-cyclohex-2-en-1-yl]acetyl]pyrrolidin-2-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc([C@@H]2CCCN2C(=O)C[C@@H]2C=CCCC2)n1 |
| InChI | InChI=1S/C18H24N2O3S/c1-2-23-18(22)14-12-24-17(19-14)15-9-6-10-20(15)16(21)11-13-7-4-3-5-8-13/h4,7,12-13,15H,2-3,5-6,8-11H2,1H3/t13-,15+/m1/s1 |
| InChIKey | OCNYWAUSJZLYOR-HIFRSBDPSA-N |
| XLogP | 3.73 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|