C19H18F3N3O2S — CID 100613872
1-[[2-[(1R)-3,4-dihydro-1H-isochromen-1-yl]acetyl]amino]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 100613872) has the molecular formula C19H18F3N3O2S and a molecular weight of 409.43 g/mol. Its IUPAC name is 1-[[2-[(1R)-3,4-dihydro-1H-isochromen-1-yl]acetyl]amino]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[[2-[(1R)-3,4-dihydro-1H-isochromen-1-yl]acetyl]amino]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100613872 |
| Molecular Formula | C19H18F3N3O2S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1-[[2-[(1R)-3,4-dihydro-1H-isochromen-1-yl]acetyl]amino]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | O=C(C[C@H]1OCCc2ccccc21)NNC(=S)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H18F3N3O2S/c20-19(21,22)14-7-3-4-8-15(14)23-18(28)25-24-17(26)11-16-13-6-2-1-5-12(13)9-10-27-16/h1-8,16H,9-11H2,(H,24,26)(H2,23,25,28)/t16-/m1/s1 |
| InChIKey | BYZADDOOEPLWDQ-MRXNPFEDSA-N |
| XLogP | 3.73 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|