C17H31NOS — CID 100614916
(3S)-3-cyclohexyl-N-[(1R,3R)-3-methylsulfanylcyclohexyl]butanamide (PubChem CID 100614916) has the molecular formula C17H31NOS and a molecular weight of 297.51 g/mol. Its IUPAC name is (3S)-3-cyclohexyl-N-[(1R,3R)-3-methylsulfanylcyclohexyl]butanamide.
| Compound Name | (3S)-3-cyclohexyl-N-[(1R,3R)-3-methylsulfanylcyclohexyl]butanamide |
|---|---|
| PubChem CID | 100614916 |
| Molecular Formula | C17H31NOS |
| Molecular Weight | 297.51 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (3S)-3-cyclohexyl-N-[(1R,3R)-3-methylsulfanylcyclohexyl]butanamide |
| SMILES | CS[C@@H]1CCC[C@@H](NC(=O)C[C@H](C)C2CCCCC2)C1 |
| InChI | InChI=1S/C17H31NOS/c1-13(14-7-4-3-5-8-14)11-17(19)18-15-9-6-10-16(12-15)20-2/h13-16H,3-12H2,1-2H3,(H,18,19)/t13-,15+,16+/m0/s1 |
| InChIKey | PFCJFQOCADGRIM-NUEKZKHPSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |