C14H28N2OS — CID 114122906
N-(3-methylsulfanylcyclohexyl)-4-(propan-2-ylamino)butanamide (PubChem CID 114122906) has the molecular formula C14H28N2OS and a molecular weight of 272.46 g/mol. Its IUPAC name is N-(3-methylsulfanylcyclohexyl)-4-(propan-2-ylamino)butanamide.
| Compound Name | N-(3-methylsulfanylcyclohexyl)-4-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 114122906 |
| Molecular Formula | C14H28N2OS |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-(3-methylsulfanylcyclohexyl)-4-(propan-2-ylamino)butanamide |
| SMILES | CSC1CCCC(NC(=O)CCCNC(C)C)C1 |
| InChI | InChI=1S/C14H28N2OS/c1-11(2)15-9-5-8-14(17)16-12-6-4-7-13(10-12)18-3/h11-13,15H,4-10H2,1-3H3,(H,16,17) |
| InChIKey | UWTLGRZPSMHKSZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|