C16H18FN3O2 — CID 100614986
(3R,5R)-1-(6-ethoxypyrimidin-4-yl)-5-(4-fluorophenyl)pyrrolidin-3-ol (PubChem CID 100614986) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is (3R,5R)-1-(6-ethoxypyrimidin-4-yl)-5-(4-fluorophenyl)pyrrolidin-3-ol.
| Compound Name | (3R,5R)-1-(6-ethoxypyrimidin-4-yl)-5-(4-fluorophenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 100614986 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (3R,5R)-1-(6-ethoxypyrimidin-4-yl)-5-(4-fluorophenyl)pyrrolidin-3-ol |
| SMILES | CCOc1cc(N2C[C@H](O)C[C@@H]2c2ccc(F)cc2)ncn1 |
| InChI | InChI=1S/C16H18FN3O2/c1-2-22-16-8-15(18-10-19-16)20-9-13(21)7-14(20)11-3-5-12(17)6-4-11/h3-6,8,10,13-14,21H,2,7,9H2,1H3/t13-,14-/m1/s1 |
| InChIKey | NVUAISFXRIGNRZ-ZIAGYGMSSA-N |
| XLogP | 2.33 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |