C14H13F2N3O — CID 100661594
(3R,5S)-5-(4-fluorophenyl)-1-(5-fluoropyrimidin-2-yl)pyrrolidin-3-ol (PubChem CID 100661594) has the molecular formula C14H13F2N3O and a molecular weight of 277.27 g/mol. Its IUPAC name is (3R,5S)-5-(4-fluorophenyl)-1-(5-fluoropyrimidin-2-yl)pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-(4-fluorophenyl)-1-(5-fluoropyrimidin-2-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 100661594 |
| Molecular Formula | C14H13F2N3O |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (3R,5S)-5-(4-fluorophenyl)-1-(5-fluoropyrimidin-2-yl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1C[C@@H](c2ccc(F)cc2)N(c2ncc(F)cn2)C1 |
| InChI | InChI=1S/C14H13F2N3O/c15-10-3-1-9(2-4-10)13-5-12(20)8-19(13)14-17-6-11(16)7-18-14/h1-4,6-7,12-13,20H,5,8H2/t12-,13+/m1/s1 |
| InChIKey | REKNHAZZAMPNFU-OLZOCXBDSA-N |
| XLogP | 2.07 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |