C18H16FN3O — CID 129350389
(3R,5S)-5-(4-fluorophenyl)-1-(1,6-naphthyridin-4-yl)pyrrolidin-3-ol (PubChem CID 129350389) has the molecular formula C18H16FN3O and a molecular weight of 309.34 g/mol. Its IUPAC name is (3R,5S)-5-(4-fluorophenyl)-1-(1,6-naphthyridin-4-yl)pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-(4-fluorophenyl)-1-(1,6-naphthyridin-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129350389 |
| Molecular Formula | C18H16FN3O |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (3R,5S)-5-(4-fluorophenyl)-1-(1,6-naphthyridin-4-yl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1C[C@@H](c2ccc(F)cc2)N(c2ccnc3ccncc23)C1 |
| InChI | InChI=1S/C18H16FN3O/c19-13-3-1-12(2-4-13)18-9-14(23)11-22(18)17-6-8-21-16-5-7-20-10-15(16)17/h1-8,10,14,18,23H,9,11H2/t14-,18+/m1/s1 |
| InChIKey | HHFHORJRLUTVIR-KDOFPFPSSA-N |
| XLogP | 3.08 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |