C14H24O3Si — CID 10061588
methyl (4R,6S)-6-methyl-4-trimethylsilyloxynon-8-en-2-ynoate (PubChem CID 10061588) has the molecular formula C14H24O3Si and a molecular weight of 268.43 g/mol. Its IUPAC name is methyl (4R,6S)-6-methyl-4-trimethylsilyloxynon-8-en-2-ynoate.
| Compound Name | methyl (4R,6S)-6-methyl-4-trimethylsilyloxynon-8-en-2-ynoate |
|---|---|
| PubChem CID | 10061588 |
| Molecular Formula | C14H24O3Si |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | methyl (4R,6S)-6-methyl-4-trimethylsilyloxynon-8-en-2-ynoate |
| SMILES | C=CC[C@H](C)C[C@H](C#CC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C14H24O3Si/c1-7-8-12(2)11-13(17-18(4,5)6)9-10-14(15)16-3/h7,12-13H,1,8,11H2,2-6H3/t12-,13-/m0/s1 |
| InChIKey | NESJSPLSKHMFDB-STQMWFEESA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|