C17H30O3Si — CID 102362687
ethyl 7-[tert-butyl(dimethyl)silyl]oxynon-8-en-2-ynoate (PubChem CID 102362687) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is ethyl 7-[tert-butyl(dimethyl)silyl]oxynon-8-en-2-ynoate.
| Compound Name | ethyl 7-[tert-butyl(dimethyl)silyl]oxynon-8-en-2-ynoate |
|---|---|
| PubChem CID | 102362687 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | ethyl 7-[tert-butyl(dimethyl)silyl]oxynon-8-en-2-ynoate |
| SMILES | C=CC(CCCC#CC(=O)OCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O3Si/c1-8-15(20-21(6,7)17(3,4)5)13-11-10-12-14-16(18)19-9-2/h8,15H,1,9-11,13H2,2-7H3 |
| InChIKey | DHQPTAVMPOGJJD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|