C31H33Cl3FN3O4S — CID 100618102
(2S)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100618102) has the molecular formula C31H33Cl3FN3O4S and a molecular weight of 669.05 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100618102 |
| Molecular Formula | C31H33Cl3FN3O4S |
| Molecular Weight | 669.05 g/mol |
| Exact Mass | 667.12 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CS(=O)(=O)N(CC(=O)N(Cc1ccc(F)cc1)[C@@H](Cc1ccccc1)C(=O)NC1CCCCC1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C31H33Cl3FN3O4S/c1-43(41,42)38(28-18-26(33)25(32)17-27(28)34)20-30(39)37(19-22-12-14-23(35)15-13-22)29(16-21-8-4-2-5-9-21)31(40)36-24-10-6-3-7-11-24/h2,4-5,8-9,12-15,17-18,24,29H,3,6-7,10-11,16,19-20H2,1H3,(H,36,40)/t29-/m0/s1 |
| InChIKey | NLBBUKRBJCMGCJ-LJAQVGFWSA-N |
| XLogP | 6.64 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.05 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|