C31H33Cl4N3O4S — CID 125075409
(2R)-2-[(4-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 125075409) has the molecular formula C31H33Cl4N3O4S and a molecular weight of 685.50 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 125075409 |
| Molecular Formula | C31H33Cl4N3O4S |
| Molecular Weight | 685.50 g/mol |
| Exact Mass | 683.09 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | CS(=O)(=O)N(CC(=O)N(Cc1ccc(Cl)cc1)[C@H](Cc1ccccc1)C(=O)NC1CCCCC1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C31H33Cl4N3O4S/c1-43(41,42)38(28-18-26(34)25(33)17-27(28)35)20-30(39)37(19-22-12-14-23(32)15-13-22)29(16-21-8-4-2-5-9-21)31(40)36-24-10-6-3-7-11-24/h2,4-5,8-9,12-15,17-18,24,29H,3,6-7,10-11,16,19-20H2,1H3,(H,36,40)/t29-/m1/s1 |
| InChIKey | IXIHHSQIASLWPU-GDLZYMKVSA-N |
| XLogP | 7.16 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.50 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|