C21H24FN3O4 — CID 100618515
methyl 3-(dimethylamino)-4-[[(2S)-2-(4-fluorophenyl)morpholine-4-carbonyl]amino]benzoate (PubChem CID 100618515) has the molecular formula C21H24FN3O4 and a molecular weight of 401.44 g/mol. Its IUPAC name is methyl 3-(dimethylamino)-4-[[(2S)-2-(4-fluorophenyl)morpholine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 3-(dimethylamino)-4-[[(2S)-2-(4-fluorophenyl)morpholine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 100618515 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | methyl 3-(dimethylamino)-4-[[(2S)-2-(4-fluorophenyl)morpholine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)N2CCO[C@@H](c3ccc(F)cc3)C2)c(N(C)C)c1 |
| InChI | InChI=1S/C21H24FN3O4/c1-24(2)18-12-15(20(26)28-3)6-9-17(18)23-21(27)25-10-11-29-19(13-25)14-4-7-16(22)8-5-14/h4-9,12,19H,10-11,13H2,1-3H3,(H,23,27)/t19-/m1/s1 |
| InChIKey | QTIPSWRRWZSQJX-LJQANCHMSA-N |
| XLogP | 3.28 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |