C16H14N4O — CID 100618809
N-[4-[(3-cyano-4-pyridinyl)amino]phenyl]cyclopropanecarboxamide (PubChem CID 100618809) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is N-[4-[(3-cyano-4-pyridinyl)amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(3-cyano-4-pyridinyl)amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 100618809 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[4-[(3-cyano-4-pyridinyl)amino]phenyl]cyclopropanecarboxamide |
| SMILES | N#Cc1cnccc1Nc1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C16H14N4O/c17-9-12-10-18-8-7-15(12)19-13-3-5-14(6-4-13)20-16(21)11-1-2-11/h3-8,10-11H,1-2H2,(H,18,19)(H,20,21) |
| InChIKey | UESFSURHDHMBAL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |