C18H17F6NO2 — CID 100619156
2-[(1R)-1-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-6-(trifluoromethyl)phenol (PubChem CID 100619156) has the molecular formula C18H17F6NO2 and a molecular weight of 393.33 g/mol. Its IUPAC name is 2-[(1R)-1-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-6-(trifluoromethyl)phenol.
| Compound Name | 2-[(1R)-1-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-6-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 100619156 |
| Molecular Formula | C18H17F6NO2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[(1R)-1-[[4-(2,2,2-trifluoroethoxy)phenyl]methylamino]ethyl]-6-(trifluoromethyl)phenol |
| SMILES | C[C@@H](NCc1ccc(OCC(F)(F)F)cc1)c1cccc(C(F)(F)F)c1O |
| InChI | InChI=1S/C18H17F6NO2/c1-11(14-3-2-4-15(16(14)26)18(22,23)24)25-9-12-5-7-13(8-6-12)27-10-17(19,20)21/h2-8,11,25-26H,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | CWKSDTFOGWGMAB-LLVKDONJSA-N |
| XLogP | 5.20 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|