C14H12F8N2O2 — CID 100620243
(2S)-2-[(3S)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-N-(2,3,4,5,6-pentafluorophenyl)propanamide (PubChem CID 100620243) has the molecular formula C14H12F8N2O2 and a molecular weight of 392.25 g/mol. Its IUPAC name is (2S)-2-[(3S)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-N-(2,3,4,5,6-pentafluorophenyl)propanamide.
| Compound Name | (2S)-2-[(3S)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
|---|---|
| PubChem CID | 100620243 |
| Molecular Formula | C14H12F8N2O2 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (2S)-2-[(3S)-3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1c(F)c(F)c(F)c(F)c1F)N1CC[C@@](O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H12F8N2O2/c1-5(24-3-2-13(26,4-24)14(20,21)22)12(25)23-11-9(18)7(16)6(15)8(17)10(11)19/h5,26H,2-4H2,1H3,(H,23,25)/t5-,13-/m0/s1 |
| InChIKey | KJOKXSOJTHMZGQ-QSGQRGAGSA-N |
| XLogP | 2.71 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|