C9H15F3N2O2 — CID 136511709
2-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]butanamide (PubChem CID 136511709) has the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]butanamide.
| Compound Name | 2-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]butanamide |
|---|---|
| PubChem CID | 136511709 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-[3-hydroxy-3-(trifluoromethyl)pyrrolidin-1-yl]butanamide |
| SMILES | CCC(C(N)=O)N1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N2O2/c1-2-6(7(13)15)14-4-3-8(16,5-14)9(10,11)12/h6,16H,2-5H2,1H3,(H2,13,15) |
| InChIKey | NOSVMSYMSLEMLY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |