C11H21F3N2O — CID 112737664
1-(1-aminobutan-2-yl)-4-(trifluoromethyl)azepan-4-ol (PubChem CID 112737664) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is 1-(1-aminobutan-2-yl)-4-(trifluoromethyl)azepan-4-ol.
| Compound Name | 1-(1-aminobutan-2-yl)-4-(trifluoromethyl)azepan-4-ol |
|---|---|
| PubChem CID | 112737664 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-(1-aminobutan-2-yl)-4-(trifluoromethyl)azepan-4-ol |
| SMILES | CCC(CN)N1CCCC(O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H21F3N2O/c1-2-9(8-15)16-6-3-4-10(17,5-7-16)11(12,13)14/h9,17H,2-8,15H2,1H3 |
| InChIKey | LDMJWUBEGWRYRH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |