C14H26N2O — CID 62921660
2-(3-azaspiro[5.5]undecan-3-yl)butanamide (PubChem CID 62921660) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-(3-azaspiro[5.5]undecan-3-yl)butanamide.
| Compound Name | 2-(3-azaspiro[5.5]undecan-3-yl)butanamide |
|---|---|
| PubChem CID | 62921660 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 2-(3-azaspiro[5.5]undecan-3-yl)butanamide |
| SMILES | CCC(C(N)=O)N1CCC2(CCCCC2)CC1 |
| InChI | InChI=1S/C14H26N2O/c1-2-12(13(15)17)16-10-8-14(9-11-16)6-4-3-5-7-14/h12H,2-11H2,1H3,(H2,15,17) |
| InChIKey | CYVOSVUKMUOQIH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |