C30H36ClN3O4S — CID 100620932
(2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100620932) has the molecular formula C30H36ClN3O4S and a molecular weight of 570.16 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100620932 |
| Molecular Formula | C30H36ClN3O4S |
| Molecular Weight | 570.16 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(Cl)c1)C(=O)CN(c1ccccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C30H36ClN3O4S/c1-4-5-18-32-30(36)28(20-24-13-7-6-8-14-24)33(21-25-15-11-16-26(31)19-25)29(35)22-34(39(3,37)38)27-17-10-9-12-23(27)2/h6-17,19,28H,4-5,18,20-22H2,1-3H3,(H,32,36)/t28-/m0/s1 |
| InChIKey | IGIBWKYSAMRXLG-NDEPHWFRSA-N |
| XLogP | 4.97 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.16 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|