C31H39N3O5S — CID 133204591
N-butyl-2-[(3-methoxyphenyl)methyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 133204591) has the molecular formula C31H39N3O5S and a molecular weight of 565.74 g/mol. Its IUPAC name is N-butyl-2-[(3-methoxyphenyl)methyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(3-methoxyphenyl)methyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133204591 |
| Molecular Formula | C31H39N3O5S |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | N-butyl-2-[(3-methoxyphenyl)methyl-[2-(2-methyl-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(OC)c1)C(=O)CN(c1ccccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C31H39N3O5S/c1-5-6-19-32-31(36)29(21-25-14-8-7-9-15-25)33(22-26-16-12-17-27(20-26)39-3)30(35)23-34(40(4,37)38)28-18-11-10-13-24(28)2/h7-18,20,29H,5-6,19,21-23H2,1-4H3,(H,32,36) |
| InChIKey | NBMNWWODNDAHTB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|