C28H31NO3S — CID 100622134
N-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]-4-(2-phenylsulfanylethoxy)benzamide (PubChem CID 100622134) has the molecular formula C28H31NO3S and a molecular weight of 461.63 g/mol. Its IUPAC name is N-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]-4-(2-phenylsulfanylethoxy)benzamide.
| Compound Name | N-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]-4-(2-phenylsulfanylethoxy)benzamide |
|---|---|
| PubChem CID | 100622134 |
| Molecular Formula | C28H31NO3S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-[(4S)-2,2-diethyl-3,4-dihydrochromen-4-yl]-4-(2-phenylsulfanylethoxy)benzamide |
| SMILES | CCC1(CC)C[C@H](NC(=O)c2ccc(OCCSc3ccccc3)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C28H31NO3S/c1-3-28(4-2)20-25(24-12-8-9-13-26(24)32-28)29-27(30)21-14-16-22(17-15-21)31-18-19-33-23-10-6-5-7-11-23/h5-17,25H,3-4,18-20H2,1-2H3,(H,29,30)/t25-/m0/s1 |
| InChIKey | KHJVBHVPEQAHRJ-VWLOTQADSA-N |
| XLogP | 6.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|