C24H31NO3 — CID 100747953
N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-4-(4-methylphenoxy)butanamide (PubChem CID 100747953) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-4-(4-methylphenoxy)butanamide.
| Compound Name | N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 100747953 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | N-[(4R)-2,2-diethyl-3,4-dihydrochromen-4-yl]-4-(4-methylphenoxy)butanamide |
| SMILES | CCC1(CC)C[C@@H](NC(=O)CCCOc2ccc(C)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C24H31NO3/c1-4-24(5-2)17-21(20-9-6-7-10-22(20)28-24)25-23(26)11-8-16-27-19-14-12-18(3)13-15-19/h6-7,9-10,12-15,21H,4-5,8,11,16-17H2,1-3H3,(H,25,26)/t21-/m1/s1 |
| InChIKey | QLDZCJLMIJOFJO-OAQYLSRUSA-N |
| XLogP | 5.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|