C23H32N2O2 — CID 100623630
(2R)-N-[[4-(diethylamino)phenyl]methyl]-2-(2,3-dimethylphenoxy)butanamide (PubChem CID 100623630) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is (2R)-N-[[4-(diethylamino)phenyl]methyl]-2-(2,3-dimethylphenoxy)butanamide.
| Compound Name | (2R)-N-[[4-(diethylamino)phenyl]methyl]-2-(2,3-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 100623630 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | (2R)-N-[[4-(diethylamino)phenyl]methyl]-2-(2,3-dimethylphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1cccc(C)c1C)C(=O)NCc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C23H32N2O2/c1-6-21(27-22-11-9-10-17(4)18(22)5)23(26)24-16-19-12-14-20(15-13-19)25(7-2)8-3/h9-15,21H,6-8,16H2,1-5H3,(H,24,26)/t21-/m1/s1 |
| InChIKey | JRWSUVIGSSLQBY-OAQYLSRUSA-N |
| XLogP | 4.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|