C21H27NO3 — CID 46778407
2-(2,3-dimethylphenoxy)-N-[(4-ethoxyphenyl)methyl]butanamide (PubChem CID 46778407) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-[(4-ethoxyphenyl)methyl]butanamide.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-[(4-ethoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 46778407 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-[(4-ethoxyphenyl)methyl]butanamide |
| SMILES | CCOc1ccc(CNC(=O)C(CC)Oc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-5-19(25-20-9-7-8-15(3)16(20)4)21(23)22-14-17-10-12-18(13-11-17)24-6-2/h7-13,19H,5-6,14H2,1-4H3,(H,22,23) |
| InChIKey | JXAHSYGWESWXEA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |