C15H27NO2 — CID 100627103
(3S)-N-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]oxolan-3-amine (PubChem CID 100627103) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (3S)-N-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]oxolan-3-amine.
| Compound Name | (3S)-N-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]oxolan-3-amine |
|---|---|
| PubChem CID | 100627103 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (3S)-N-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]oxolan-3-amine |
| SMILES | CCO[C@@H]1C[C@@H](N[C@H]2CCOC2)C12CCCCC2 |
| InChI | InChI=1S/C15H27NO2/c1-2-18-14-10-13(16-12-6-9-17-11-12)15(14)7-4-3-5-8-15/h12-14,16H,2-11H2,1H3/t12-,13+,14+/m0/s1 |
| InChIKey | GKRIWSMPVXEAOW-BFHYXJOUSA-N |
| XLogP | 2.49 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |