C23H34N2O5 — CID 100627107
benzyl 4-[[(3-methoxy-3-oxopropyl)-(oxan-4-yl)amino]methyl]piperidine-1-carboxylate (PubChem CID 100627107) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is benzyl 4-[[(3-methoxy-3-oxopropyl)-(oxan-4-yl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[(3-methoxy-3-oxopropyl)-(oxan-4-yl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 100627107 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | benzyl 4-[[(3-methoxy-3-oxopropyl)-(oxan-4-yl)amino]methyl]piperidine-1-carboxylate |
| SMILES | COC(=O)CCN(CC1CCN(C(=O)OCc2ccccc2)CC1)C1CCOCC1 |
| InChI | InChI=1S/C23H34N2O5/c1-28-22(26)9-14-25(21-10-15-29-16-11-21)17-19-7-12-24(13-8-19)23(27)30-18-20-5-3-2-4-6-20/h2-6,19,21H,7-18H2,1H3 |
| InChIKey | JVACHCADXONGGX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |