About N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide
N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide (PubChem CID 100630418) has the molecular formula C20H25FN2O3
and a molecular weight of 360.43 g/mol. Its IUPAC name is N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide |
| PubChem CID | 100630418 |
| Molecular Formula | C20H25FN2O3 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide |
| SMILES | CCN(C(=O)c1onc(-c2ccc(F)cc2)c1[C@H](C)O)C1CCCCC1 |
| InChI | InChI=1S/C20H25FN2O3/c1-3-23(16-7-5-4-6-8-16)20(25)19-17(13(2)24)18(22-26-19)14-9-11-15(21)12-10-14/h9-13,16,24H,3-8H2,1-2H3/t13-/m0/s1 |
| InChIKey | ZWVGWAHWVVSQQI-ZDUSSCGKSA-N |
| XLogP | 4.33 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide?
The IUPAC name of N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide (CID 100630418) is N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide is CCN(C(=O)c1onc(-c2ccc(F)cc2)c1[C@H](C)O)C1CCCCC1.
What is the InChIKey of N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide?
The InChIKey is ZWVGWAHWVVSQQI-ZDUSSCGKSA-N. The full InChI is InChI=1S/C20H25FN2O3/c1-3-23(16-7-5-4-6-8-16)20(25)19-17(13(2)24)18(22-26-19)14-9-11-15(21)12-10-14/h9-13,16,24H,3-8H2,1-2H3/t13-/m0/s1.
What are the key properties of N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide?
N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide has a molecular weight of 360.43 g/mol, XLogP of 4.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-ethyl-3-(4-fluorophenyl)-4-[(1S)-1-hydroxyethyl]-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 100630418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).