C18H23N3O4 — CID 100630644
3-amino-4-(2,5-dimethoxyanilino)-N-(2-methoxyethyl)benzamide (PubChem CID 100630644) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-amino-4-(2,5-dimethoxyanilino)-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-amino-4-(2,5-dimethoxyanilino)-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 100630644 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-amino-4-(2,5-dimethoxyanilino)-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(Nc2cc(OC)ccc2OC)c(N)c1 |
| InChI | InChI=1S/C18H23N3O4/c1-23-9-8-20-18(22)12-4-6-15(14(19)10-12)21-16-11-13(24-2)5-7-17(16)25-3/h4-7,10-11,21H,8-9,19H2,1-3H3,(H,20,22) |
| InChIKey | AIOFOXLPQAFILJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|