C17H20ClN3O2 — CID 100631228
3-amino-4-(3-chloro-4-methoxyanilino)-N-propylbenzamide (PubChem CID 100631228) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 3-amino-4-(3-chloro-4-methoxyanilino)-N-propylbenzamide.
| Compound Name | 3-amino-4-(3-chloro-4-methoxyanilino)-N-propylbenzamide |
|---|---|
| PubChem CID | 100631228 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 3-amino-4-(3-chloro-4-methoxyanilino)-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(Nc2ccc(OC)c(Cl)c2)c(N)c1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-3-8-20-17(22)11-4-6-15(14(19)9-11)21-12-5-7-16(23-2)13(18)10-12/h4-7,9-10,21H,3,8,19H2,1-2H3,(H,20,22) |
| InChIKey | FVZCUHSEIKWLSI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|