C7H13N4O7P — CID 10063126
[(2R,3S,4R,6S)-3,4-dihydroxy-6-(2H-tetrazol-5-yl)oxan-2-yl]methyl dihydrogen phosphate (PubChem CID 10063126) has the molecular formula C7H13N4O7P and a molecular weight of 296.18 g/mol. Its IUPAC name is [(2R,3S,4R,6S)-3,4-dihydroxy-6-(2H-tetrazol-5-yl)oxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,6S)-3,4-dihydroxy-6-(2H-tetrazol-5-yl)oxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10063126 |
| Molecular Formula | C7H13N4O7P |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | [(2R,3S,4R,6S)-3,4-dihydroxy-6-(2H-tetrazol-5-yl)oxan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@H](c2nn[nH]n2)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H13N4O7P/c12-3-1-4(7-8-10-11-9-7)18-5(6(3)13)2-17-19(14,15)16/h3-6,12-13H,1-2H2,(H2,14,15,16)(H,8,9,10,11)/t3-,4+,5-,6+/m1/s1 |
| InChIKey | DINRJTBFHXLNFA-MOJAZDJTSA-N |
| XLogP | -2.14 |
| TPSA | 170.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|