C16H24N4O2S — CID 100631910
3-[3-(4,4-dimethylpentylsulfanyl)-5-(furan-2-yl)-1,2,4-triazol-4-yl]propanamide (PubChem CID 100631910) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 3-[3-(4,4-dimethylpentylsulfanyl)-5-(furan-2-yl)-1,2,4-triazol-4-yl]propanamide.
| Compound Name | 3-[3-(4,4-dimethylpentylsulfanyl)-5-(furan-2-yl)-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 100631910 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-[3-(4,4-dimethylpentylsulfanyl)-5-(furan-2-yl)-1,2,4-triazol-4-yl]propanamide |
| SMILES | CC(C)(C)CCCSc1nnc(-c2ccco2)n1CCC(N)=O |
| InChI | InChI=1S/C16H24N4O2S/c1-16(2,3)8-5-11-23-15-19-18-14(12-6-4-10-22-12)20(15)9-7-13(17)21/h4,6,10H,5,7-9,11H2,1-3H3,(H2,17,21) |
| InChIKey | KIRIJBDFDBLQCG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|