C14H14F2N2O4S — CID 100632728
2-[2-(2,2-difluoroethoxy)ethylsulfanyl]-5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3,4-oxadiazole (PubChem CID 100632728) has the molecular formula C14H14F2N2O4S and a molecular weight of 344.34 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethylsulfanyl]-5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethylsulfanyl]-5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 100632728 |
| Molecular Formula | C14H14F2N2O4S |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethylsulfanyl]-5-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]-1,3,4-oxadiazole |
| SMILES | FC(F)COCCSc1nnc([C@@H]2COc3ccccc3O2)o1 |
| InChI | InChI=1S/C14H14F2N2O4S/c15-12(16)8-19-5-6-23-14-18-17-13(22-14)11-7-20-9-3-1-2-4-10(9)21-11/h1-4,11-12H,5-8H2/t11-/m0/s1 |
| InChIKey | OKBDYMGEBULQDL-NSHDSACASA-N |
| XLogP | 2.96 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|