C19H18N2O5S2 — CID 55833708
2-[3-(benzenesulfonyl)propylsulfanyl]-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazole (PubChem CID 55833708) has the molecular formula C19H18N2O5S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)propylsulfanyl]-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[3-(benzenesulfonyl)propylsulfanyl]-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 55833708 |
| Molecular Formula | C19H18N2O5S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-[3-(benzenesulfonyl)propylsulfanyl]-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-1,3,4-oxadiazole |
| SMILES | O=S(=O)(CCCSc1nnc(C2COc3ccccc3O2)o1)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O5S2/c22-28(23,14-7-2-1-3-8-14)12-6-11-27-19-21-20-18(26-19)17-13-24-15-9-4-5-10-16(15)25-17/h1-5,7-10,17H,6,11-13H2 |
| InChIKey | UUTHCGVIRJGZAN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|