C19H20F2N2O3 — CID 100633185
(2R)-2-[[2-(4-fluorophenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]-N-methylpropanamide (PubChem CID 100633185) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is (2R)-2-[[2-(4-fluorophenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]-N-methylpropanamide.
| Compound Name | (2R)-2-[[2-(4-fluorophenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 100633185 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2R)-2-[[2-(4-fluorophenoxy)acetyl]-[(2-fluorophenyl)methyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)[C@@H](C)N(Cc1ccccc1F)C(=O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C19H20F2N2O3/c1-13(19(25)22-2)23(11-14-5-3-4-6-17(14)21)18(24)12-26-16-9-7-15(20)8-10-16/h3-10,13H,11-12H2,1-2H3,(H,22,25)/t13-/m1/s1 |
| InChIKey | NNHKJFLTAGSXHX-CYBMUJFWSA-N |
| XLogP | 2.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |