C21H25FN2O3 — CID 100629757
N-[(2-fluorophenyl)methyl]-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]-4-phenoxybutanamide (PubChem CID 100629757) has the molecular formula C21H25FN2O3 and a molecular weight of 372.44 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]-4-phenoxybutanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 100629757 |
| Molecular Formula | C21H25FN2O3 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N-[(2R)-1-(methylamino)-1-oxopropan-2-yl]-4-phenoxybutanamide |
| SMILES | CNC(=O)[C@@H](C)N(Cc1ccccc1F)C(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C21H25FN2O3/c1-16(21(26)23-2)24(15-17-9-6-7-12-19(17)22)20(25)13-8-14-27-18-10-4-3-5-11-18/h3-7,9-12,16H,8,13-15H2,1-2H3,(H,23,26)/t16-/m1/s1 |
| InChIKey | QTYKWWVWKUKGNZ-MRXNPFEDSA-N |
| XLogP | 3.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|