C27H35FN2O3 — CID 133251250
N-[1-(cyclohexylamino)-1-oxopropan-2-yl]-N-[(2-fluorophenyl)methyl]-4-(4-methylphenoxy)butanamide (PubChem CID 133251250) has the molecular formula C27H35FN2O3 and a molecular weight of 454.59 g/mol. Its IUPAC name is N-[1-(cyclohexylamino)-1-oxopropan-2-yl]-N-[(2-fluorophenyl)methyl]-4-(4-methylphenoxy)butanamide.
| Compound Name | N-[1-(cyclohexylamino)-1-oxopropan-2-yl]-N-[(2-fluorophenyl)methyl]-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 133251250 |
| Molecular Formula | C27H35FN2O3 |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | N-[1-(cyclohexylamino)-1-oxopropan-2-yl]-N-[(2-fluorophenyl)methyl]-4-(4-methylphenoxy)butanamide |
| SMILES | Cc1ccc(OCCCC(=O)N(Cc2ccccc2F)C(C)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C27H35FN2O3/c1-20-14-16-24(17-15-20)33-18-8-13-26(31)30(19-22-9-6-7-12-25(22)28)21(2)27(32)29-23-10-4-3-5-11-23/h6-7,9,12,14-17,21,23H,3-5,8,10-11,13,18-19H2,1-2H3,(H,29,32) |
| InChIKey | FTXILENXILPGGI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|