C24H28FIN2O3 — CID 133174912
N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide (PubChem CID 133174912) has the molecular formula C24H28FIN2O3 and a molecular weight of 538.40 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide.
| Compound Name | N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 133174912 |
| Molecular Formula | C24H28FIN2O3 |
| Molecular Weight | 538.40 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]propanamide |
| SMILES | CC(C(=O)NC1CCCCC1)N(Cc1ccccc1F)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C24H28FIN2O3/c1-17(24(30)27-20-8-3-2-4-9-20)28(15-18-7-5-6-10-22(18)25)23(29)16-31-21-13-11-19(26)12-14-21/h5-7,10-14,17,20H,2-4,8-9,15-16H2,1H3,(H,27,30) |
| InChIKey | NHTLUHMOOFWVDU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|