C25H31FN2O3 — CID 133174936
N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(3-methylphenoxy)acetyl]amino]propanamide (PubChem CID 133174936) has the molecular formula C25H31FN2O3 and a molecular weight of 426.53 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(3-methylphenoxy)acetyl]amino]propanamide.
| Compound Name | N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(3-methylphenoxy)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 133174936 |
| Molecular Formula | C25H31FN2O3 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(3-methylphenoxy)acetyl]amino]propanamide |
| SMILES | Cc1cccc(OCC(=O)N(Cc2ccccc2F)C(C)C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C25H31FN2O3/c1-18-9-8-13-22(15-18)31-17-24(29)28(16-20-10-6-7-14-23(20)26)19(2)25(30)27-21-11-4-3-5-12-21/h6-10,13-15,19,21H,3-5,11-12,16-17H2,1-2H3,(H,27,30) |
| InChIKey | JFSOPONHKNHDFP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |