C27H35FN2O3 — CID 133174742
N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]propanamide (PubChem CID 133174742) has the molecular formula C27H35FN2O3 and a molecular weight of 454.59 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]propanamide.
| Compound Name | N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 133174742 |
| Molecular Formula | C27H35FN2O3 |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | N-cyclohexyl-2-[(2-fluorophenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]propanamide |
| SMILES | CC(C)c1ccc(OCC(=O)N(Cc2ccccc2F)C(C)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C27H35FN2O3/c1-19(2)21-13-15-24(16-14-21)33-18-26(31)30(17-22-9-7-8-12-25(22)28)20(3)27(32)29-23-10-5-4-6-11-23/h7-9,12-16,19-20,23H,4-6,10-11,17-18H2,1-3H3,(H,29,32) |
| InChIKey | RLYWVTJNAJRVSR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |