C20H28N2O3S — CID 100633383
N-[(1R,1aS,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-2-[(4-methylcyclohexyl)sulfamoyl]acetamide (PubChem CID 100633383) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is N-[(1R,1aS,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-2-[(4-methylcyclohexyl)sulfamoyl]acetamide.
| Compound Name | N-[(1R,1aS,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-2-[(4-methylcyclohexyl)sulfamoyl]acetamide |
|---|---|
| PubChem CID | 100633383 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(1R,1aS,7bS)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-2-[(4-methylcyclohexyl)sulfamoyl]acetamide |
| SMILES | CC1CCC(NS(=O)(=O)CC(=O)N[C@@H]2[C@H]3CCc4ccccc4[C@H]32)CC1 |
| InChI | InChI=1S/C20H28N2O3S/c1-13-6-9-15(10-7-13)22-26(24,25)12-18(23)21-20-17-11-8-14-4-2-3-5-16(14)19(17)20/h2-5,13,15,17,19-20,22H,6-12H2,1H3,(H,21,23)/t13?,15?,17-,19+,20+/m0/s1 |
| InChIKey | JCPGNJUGUREIFL-LXIGQZRCSA-N |
| XLogP | 2.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |