C17H17NOS2 — CID 97237561
N-[(1R,1aR,7bR)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-2-thiophen-2-ylsulfanylacetamide (PubChem CID 97237561) has the molecular formula C17H17NOS2 and a molecular weight of 315.46 g/mol. Its IUPAC name is N-[(1R,1aR,7bR)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-2-thiophen-2-ylsulfanylacetamide.
| Compound Name | N-[(1R,1aR,7bR)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-2-thiophen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 97237561 |
| Molecular Formula | C17H17NOS2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-[(1R,1aR,7bR)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-2-thiophen-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1cccs1)N[C@@H]1[C@@H]2CCc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C17H17NOS2/c19-14(10-21-15-6-3-9-20-15)18-17-13-8-7-11-4-1-2-5-12(11)16(13)17/h1-6,9,13,16-17H,7-8,10H2,(H,18,19)/t13-,16+,17-/m1/s1 |
| InChIKey | FLVQJTJZHSBULD-XOKHGSTOSA-N |
| XLogP | 3.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |