C19H23N3OS — CID 99854195
3-[(1R,1aR,7bR)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-1-methyl-1-[(2R)-2-(1,3-thiazol-2-yl)propyl]urea (PubChem CID 99854195) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 3-[(1R,1aR,7bR)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-1-methyl-1-[(2R)-2-(1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 3-[(1R,1aR,7bR)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-1-methyl-1-[(2R)-2-(1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 99854195 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-[(1R,1aR,7bR)-1a,2,3,7b-tetrahydro-1H-cyclopropa[a]naphthalen-1-yl]-1-methyl-1-[(2R)-2-(1,3-thiazol-2-yl)propyl]urea |
| SMILES | C[C@H](CN(C)C(=O)N[C@@H]1[C@@H]2CCc3ccccc3[C@@H]21)c1nccs1 |
| InChI | InChI=1S/C19H23N3OS/c1-12(18-20-9-10-24-18)11-22(2)19(23)21-17-15-8-7-13-5-3-4-6-14(13)16(15)17/h3-6,9-10,12,15-17H,7-8,11H2,1-2H3,(H,21,23)/t12-,15-,16+,17-/m1/s1 |
| InChIKey | PYCXZYJKWZLCOV-VDNDLQMASA-N |
| XLogP | 3.62 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |