C21H26N2O5 — CID 100636227
N-[2-(4-hydroxy-2-propoxyanilino)-2-oxoethyl]-4-propan-2-yloxybenzamide (PubChem CID 100636227) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[2-(4-hydroxy-2-propoxyanilino)-2-oxoethyl]-4-propan-2-yloxybenzamide.
| Compound Name | N-[2-(4-hydroxy-2-propoxyanilino)-2-oxoethyl]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 100636227 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[2-(4-hydroxy-2-propoxyanilino)-2-oxoethyl]-4-propan-2-yloxybenzamide |
| SMILES | CCCOc1cc(O)ccc1NC(=O)CNC(=O)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-4-11-27-19-12-16(24)7-10-18(19)23-20(25)13-22-21(26)15-5-8-17(9-6-15)28-14(2)3/h5-10,12,14,24H,4,11,13H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | ZWQFNWWJEMWJDC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|