C21H25NO5 — CID 42965917
2-(2-methylphenoxy)ethyl 2-[(4-propan-2-yloxybenzoyl)amino]acetate (PubChem CID 42965917) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is 2-(2-methylphenoxy)ethyl 2-[(4-propan-2-yloxybenzoyl)amino]acetate.
| Compound Name | 2-(2-methylphenoxy)ethyl 2-[(4-propan-2-yloxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 42965917 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-(2-methylphenoxy)ethyl 2-[(4-propan-2-yloxybenzoyl)amino]acetate |
| SMILES | Cc1ccccc1OCCOC(=O)CNC(=O)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C21H25NO5/c1-15(2)27-18-10-8-17(9-11-18)21(24)22-14-20(23)26-13-12-25-19-7-5-4-6-16(19)3/h4-11,15H,12-14H2,1-3H3,(H,22,24) |
| InChIKey | GYZSYLIHBCUJHA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|