C22H27NO5 — CID 40751141
2-(2-methylphenoxy)ethyl (2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 40751141) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-(2-methylphenoxy)ethyl (2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | 2-(2-methylphenoxy)ethyl (2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 40751141 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-(2-methylphenoxy)ethyl (2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | COc1ccc(C(=O)N[C@H](C(=O)OCCOc2ccccc2C)C(C)C)cc1 |
| InChI | InChI=1S/C22H27NO5/c1-15(2)20(23-21(24)17-9-11-18(26-4)12-10-17)22(25)28-14-13-27-19-8-6-5-7-16(19)3/h5-12,15,20H,13-14H2,1-4H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | BFDNUBYTOJXGTK-FQEVSTJZSA-N |
| XLogP | 3.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|