C21H24BrNO4 — CID 18227253
2-(4-bromophenoxy)ethyl (2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoate (PubChem CID 18227253) has the molecular formula C21H24BrNO4 and a molecular weight of 434.33 g/mol. Its IUPAC name is 2-(4-bromophenoxy)ethyl (2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoate.
| Compound Name | 2-(4-bromophenoxy)ethyl (2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 18227253 |
| Molecular Formula | C21H24BrNO4 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2-(4-bromophenoxy)ethyl (2S)-3-methyl-2-[(2-methylbenzoyl)amino]butanoate |
| SMILES | Cc1ccccc1C(=O)N[C@H](C(=O)OCCOc1ccc(Br)cc1)C(C)C |
| InChI | InChI=1S/C21H24BrNO4/c1-14(2)19(23-20(24)18-7-5-4-6-15(18)3)21(25)27-13-12-26-17-10-8-16(22)9-11-17/h4-11,14,19H,12-13H2,1-3H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | GQQMBAHPBYWZRX-IBGZPJMESA-N |
| XLogP | 4.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|