About 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine
4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine (PubChem CID 100637336) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine |
| PubChem CID | 100637336 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine |
| SMILES | CC(C)(C)CCCN1CCCC[C@@H]1CN1CCOCC1 |
| InChI | InChI=1S/C17H34N2O/c1-17(2,3)8-6-10-19-9-5-4-7-16(19)15-18-11-13-20-14-12-18/h16H,4-15H2,1-3H3/t16-/m1/s1 |
| InChIKey | DFBBERXTNDTUEW-MRXNPFEDSA-N |
| XLogP | 3.00 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine?
The IUPAC name of 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine (CID 100637336) is 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine.
What is the SMILES notation for 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine?
The canonical SMILES for 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine is CC(C)(C)CCCN1CCCC[C@@H]1CN1CCOCC1.
What is the InChIKey of 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine?
The InChIKey is DFBBERXTNDTUEW-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H34N2O/c1-17(2,3)8-6-10-19-9-5-4-7-16(19)15-18-11-13-20-14-12-18/h16H,4-15H2,1-3H3/t16-/m1/s1.
What are the key properties of 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine?
4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine has a molecular weight of 282.47 g/mol, XLogP of 3.00, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2R)-1-(4,4-dimethylpentyl)piperidin-2-yl]methyl]morpholine is sourced from PubChem (CID 100637336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).