C17H23F3N2O — CID 99930489
4-[[(2S)-1-[(2,3,4-trifluorophenyl)methyl]piperidin-2-yl]methyl]morpholine (PubChem CID 99930489) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is 4-[[(2S)-1-[(2,3,4-trifluorophenyl)methyl]piperidin-2-yl]methyl]morpholine.
| Compound Name | 4-[[(2S)-1-[(2,3,4-trifluorophenyl)methyl]piperidin-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 99930489 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 4-[[(2S)-1-[(2,3,4-trifluorophenyl)methyl]piperidin-2-yl]methyl]morpholine |
| SMILES | Fc1ccc(CN2CCCC[C@H]2CN2CCOCC2)c(F)c1F |
| InChI | InChI=1S/C17H23F3N2O/c18-15-5-4-13(16(19)17(15)20)11-22-6-2-1-3-14(22)12-21-7-9-23-10-8-21/h4-5,14H,1-3,6-12H2/t14-/m0/s1 |
| InChIKey | IVUMFVIRKPDJDF-AWEZNQCLSA-N |
| XLogP | 2.79 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|