C18H21N3O2S — CID 100638212
N-[3-[(1S)-1-[[4-(cyanomethyl)phenyl]methylamino]ethyl]phenyl]methanesulfonamide (PubChem CID 100638212) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[3-[(1S)-1-[[4-(cyanomethyl)phenyl]methylamino]ethyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(1S)-1-[[4-(cyanomethyl)phenyl]methylamino]ethyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 100638212 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[3-[(1S)-1-[[4-(cyanomethyl)phenyl]methylamino]ethyl]phenyl]methanesulfonamide |
| SMILES | C[C@H](NCc1ccc(CC#N)cc1)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H21N3O2S/c1-14(17-4-3-5-18(12-17)21-24(2,22)23)20-13-16-8-6-15(7-9-16)10-11-19/h3-9,12,14,20-21H,10,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | RWQYSGRANIEHRT-AWEZNQCLSA-N |
| XLogP | 2.97 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |