C19H25N3O3S — CID 75455956
2-[1-[3-(methanesulfonamido)phenyl]ethylamino]-N-[(2-methylphenyl)methyl]acetamide (PubChem CID 75455956) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-[1-[3-(methanesulfonamido)phenyl]ethylamino]-N-[(2-methylphenyl)methyl]acetamide.
| Compound Name | 2-[1-[3-(methanesulfonamido)phenyl]ethylamino]-N-[(2-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 75455956 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-[1-[3-(methanesulfonamido)phenyl]ethylamino]-N-[(2-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccccc1CNC(=O)CNC(C)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H25N3O3S/c1-14-7-4-5-8-17(14)12-21-19(23)13-20-15(2)16-9-6-10-18(11-16)22-26(3,24)25/h4-11,15,20,22H,12-13H2,1-3H3,(H,21,23) |
| InChIKey | HEQMGLMLRJWSNC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |